CAS 956951-04-5

1-(5-methyl-1-propyl-1H-pyrazol-4-yl)ethanone

Description:

1-(5-methyl-1-propyl-1H-pyrazol-4-yl)ethanone, identified by its CAS number 956951-04-5, is an organic compound characterized by its pyrazole ring structure, which contributes to its unique chemical properties. This compound features a ketone functional group (ethanone) attached to a pyrazole moiety, specifically at the 4-position, with a propyl and a methyl substituent enhancing its molecular complexity. The presence of these substituents can influence its reactivity, solubility, and potential biological activity. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic attacks and condensation reactions, due to the electrophilic nature of the carbonyl group. Additionally, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of the functional groups and the overall molecular geometry. Overall, this compound represents a class of pyrazole derivatives that could have applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₉H₁₄N₂O

InChI: InChI=1/C9H14N2O/c1-4-5-11-7(2)9(6-10-11)8(3)12/h6H,4-5H2,1-3H3

SMILES: CCCn1c(C)c(cn1)C(=O)C

Synonyms:

• ethanone, 1-(5-methyl-1-propyl-1H-pyrazol-4-yl)-
• 1-(5-Methyl-1-propyl-1H-pyrazol-4-yl)ethanone

1-(5-Methyl-1-propyl-1H-pyrazol-4-yl)ethanone

CAS: 956951-04-5

Formula: C₉H₁₄N₂O

Molecular weight: 166.2203

Ref: IN-DA005Z08

1-(5-methyl-1-propyl-1H-pyrazol-4-yl)ethanone

CAS: 956951-04-5

Formula: C₉H₁₄N₂O

Purity: 95.0%

Molecular weight: 166.224

Ref: 10-F308709