CymitQuimica logo

CAS 956951-08-9

:

3-Methyl-1-propyl-1H-pyrazole-4-methanamine

Description:
3-Methyl-1-propyl-1H-pyrazole-4-methanamine, identified by its CAS number 956951-08-9, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a propyl group attached to the pyrazole, contributing to its unique properties. The presence of the methanamine functional group indicates that it has an amine (-NH2) group, which can participate in hydrogen bonding and may influence its solubility and reactivity. Generally, compounds like this can exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure. Additionally, the compound's stability and reactivity can be influenced by the substituents on the pyrazole ring, which may affect its potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H15N3
InChI:InChI=1S/C8H15N3/c1-3-4-11-6-8(5-9)7(2)10-11/h6H,3-5,9H2,1-2H3
InChI key:InChIKey=YAVQVLJLLOUMIK-UHFFFAOYSA-N
SMILES:C(CC)N1C=C(CN)C(C)=N1
Synonyms:
  • 3-Methyl-1-propyl-1H-pyrazole-4-methanamine
  • 1H-Pyrazole-4-methanamine, 3-methyl-1-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.