CymitQuimica logo

CAS 956961-11-8

:

1-[(1-Ethyl-5-methyl-1H-pyrazol-4-yl)sulfonyl]-3-piperidinecarboxylic acid

Description:
1-[(1-Ethyl-5-methyl-1H-pyrazol-4-yl)sulfonyl]-3-piperidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a piperidine ring and a pyrazole moiety. The presence of a sulfonyl group enhances its reactivity and solubility in polar solvents. This compound typically exhibits properties such as moderate to high polarity due to the sulfonyl and carboxylic acid functional groups, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of novel therapeutic agents. The compound's stability is influenced by the piperidine and pyrazole rings, which can provide a degree of rigidity. Additionally, the ethyl and methyl substituents contribute to its lipophilicity, potentially affecting its pharmacokinetic properties. Overall, this compound's unique combination of functional groups and structural features positions it as a candidate for further investigation in medicinal chemistry.
Formula:C12H19N3O4S
InChI:InChI=1S/C12H19N3O4S/c1-3-15-9(2)11(7-13-15)20(18,19)14-6-4-5-10(8-14)12(16)17/h7,10H,3-6,8H2,1-2H3,(H,16,17)
InChI key:InChIKey=CAWIBQKNCMGPNV-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(C)N(CC)N=C1)N2CC(C(O)=O)CCC2
Synonyms:
  • 1-[(1-Ethyl-5-methyl-1H-pyrazol-4-yl)sulfonyl]-3-piperidinecarboxylic acid
  • 3-Piperidinecarboxylic acid, 1-[(1-ethyl-5-methyl-1H-pyrazol-4-yl)sulfonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.