CAS 95701-58-9
:C,C′-Di-3-pyridinyl N,N′-1,6-hexanediylbis[N-methylcarbamate]
Description:
C,C′-Di-3-pyridinyl N,N′-1,6-hexanediylbis[N-methylcarbamate], with the CAS number 95701-58-9, is a chemical compound characterized by its dual pyridine rings and a hexanediyl linker. This compound features two N-methylcarbamate functional groups, which contribute to its potential biological activity and reactivity. The presence of pyridine rings suggests that it may exhibit properties typical of nitrogen-containing heterocycles, such as basicity and the ability to participate in coordination chemistry. The hexanediyl chain provides a flexible spacer that can influence the compound's conformation and interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals, due to its structural features that could facilitate interactions with enzymes or receptors. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it a candidate for further investigation in various chemical and biological applications.
Formula:C20H26N4O4
InChI:InChI=1S/C20H26N4O4/c1-23(19(25)27-17-9-7-11-21-15-17)13-5-3-4-6-14-24(2)20(26)28-18-10-8-12-22-16-18/h7-12,15-16H,3-6,13-14H2,1-2H3
InChI key:InChIKey=YCEBUCSHXWRUJW-UHFFFAOYSA-N
SMILES:O(C(N(CCCCCCN(C(OC=1C=CC=NC1)=O)C)C)=O)C=2C=CC=NC2
Synonyms:- Carbamic acid, hexamethylenebis[methyl-, di-3-pyridyl ester
- Carbamic acid, N,N′-1,6-hexanediylbis[N-methyl-, C,C′-di-3-pyridinyl ester
- C,C′-Di-3-pyridinyl N,N′-1,6-hexanediylbis[N-methylcarbamate]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
