CAS 957034-52-5

[4-(5-amino-1,3,4-thiadiazol-2-yl)phenyl]boronic acid

Description:

[4-(5-amino-1,3,4-thiadiazol-2-yl)phenyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group and a thiadiazole moiety. This compound features a phenyl ring substituted with a 5-amino-1,3,4-thiadiazole group, which contributes to its potential biological activity. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including drug development and materials science. The presence of the thiadiazole ring may impart unique electronic and structural properties, enhancing its reactivity and interaction with biological targets. Additionally, the amino group can participate in hydrogen bonding and further functionalization, which may be advantageous in medicinal chemistry. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of targeted therapies or as a building block in organic synthesis.

Formula: C₈H₈BN₃O₂S

InChI: InChI=1/C8H8BN3O2S/c10-8-12-11-7(15-8)5-1-3-6(4-2-5)9(13)14/h1-4,13-14H,(H2,10,12)

SMILES: c1cc(ccc1c1n[nH]c(=N)s1)B(O)O

4-(5-Amino-1,3,4-thiadiazol-2-yl)phenylboronic acid

CAS: 957034-52-5

Formula: C₈H₈BN₃O₂S

Molecular weight: 221.0440

Ref: IN-DA005Z06

4-(5-Amino-1,3,4-thiadiazol-2-yl)benzeneboronic acid

CAS: 957034-52-5

4-(5-Amino-1,3,4-thiadiazol-2-yl)benzeneboronic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 221.04g/mol

Ref: 54-OR8587