CAS 957034-73-0
:N-[4-(3-Methyl-1H-pyrazol-1-yl)phenyl]cyclopropanecarboxamide
Description:
N-[4-(3-Methyl-1H-pyrazol-1-yl)phenyl]cyclopropanecarboxamide is a chemical compound characterized by its unique structure, which includes a cyclopropanecarboxamide moiety linked to a phenyl group substituted with a 3-methyl-1H-pyrazole. This compound typically exhibits properties associated with both amides and heterocyclic compounds, such as moderate solubility in organic solvents and potential biological activity due to the presence of the pyrazole ring, which is known for its role in various pharmacological applications. The cyclopropane ring contributes to the rigidity of the molecule, potentially influencing its interaction with biological targets. The presence of the pyrazole and phenyl groups may enhance its lipophilicity and ability to engage in π-π stacking interactions, which are important in drug design. Overall, this compound may be of interest in medicinal chemistry for its potential therapeutic applications, although specific biological activity and safety profiles would require further investigation through experimental studies.
Formula:C14H15N3O
InChI:InChI=1S/C14H15N3O/c1-10-8-9-17(16-10)13-6-4-12(5-7-13)15-14(18)11-2-3-11/h4-9,11H,2-3H2,1H3,(H,15,18)
InChI key:InChIKey=IYIHXSJLXGXNIH-UHFFFAOYSA-N
SMILES:CC1=NN(C=C1)C2=CC=C(NC(=O)C3CC3)C=C2
Synonyms:- N-[4-(3-Methyl-1H-pyrazol-1-yl)phenyl]cyclopropanecarboxamide
- Cyclopropanecarboxamide, N-[4-(3-methyl-1H-pyrazol-1-yl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.