CAS 957034-74-1

(3-benzyloxy-4-fluoro-phenyl)boronic acid

Description:

(3-Benzyloxy-4-fluoro-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. This compound features a phenyl ring substituted with a benzyloxy group and a fluorine atom, which can influence its reactivity and solubility. The presence of the fluorine atom may enhance the compound's electronic properties, potentially affecting its interactions in biological systems or catalysis. The boronic acid moiety contributes to its acidity and reactivity, allowing it to participate in cross-coupling reactions, which are valuable in the synthesis of complex organic molecules. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the aromatic system and functional groups that can facilitate further modifications. Overall, (3-benzyloxy-4-fluoro-phenyl)boronic acid is a versatile compound with significant implications in organic synthesis and drug development.

Formula: C₁₃H₁₂BFO₃

InChI: InChI=1/C13H12BFO3/c15-12-7-6-11(14(16)17)8-13(12)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2

SMILES: c1ccc(cc1)COc1cc(ccc1F)B(O)O

Synonyms:

• [3-(Benzyloxy)-4-fluorophenyl]boronic acid
• boronic acid, B-[4-fluoro-3-(phenylmethoxy)phenyl]-

3-Benzyloxy-4-Fluorophenylboronic Acid

CAS: 957034-74-1

Formula: C₁₃H₁₂BFO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 246.0420

Ref: IN-DA00H8L1

3-(Benzyloxy)-4-fluorobenzeneboronic acid

CAS: 957034-74-1

3-(Benzyloxy)-4-fluorobenzeneboronic acid

Formula: C₁₃H₁₂BFO₃

Purity: 98%

Color and Shape: white solid

Molecular weight: 246.04g/mol

Ref: 54-PC7572

3-Benzyloxy-4-fluorophenylboronic acid

CAS: 957034-74-1

Formula: C₁₃H₁₂BFO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 246.04

Ref: 10-F219432