CAS 957035-26-6

2-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]-4-quinolinecarboxylic acid

Description:

2-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]-4-quinolinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a quinoline ring and a pyrazole moiety. The presence of the carboxylic acid functional group contributes to its acidic properties, while the dimethyl-substituted pyrazole enhances its potential for biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may also affect its bioavailability and therapeutic efficacy. Additionally, the specific arrangement of substituents can lead to diverse chemical behaviors, making it a candidate for further research in drug development or as a biochemical probe. Overall, 2-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]-4-quinolinecarboxylic acid represents a complex and potentially valuable compound in the field of organic and medicinal chemistry.

Formula: C₁₆H₁₅N₃O₂

InChI: InChI=1S/C16H15N3O2/c1-10-7-11(2)19(18-10)9-12-8-14(16(20)21)13-5-3-4-6-15(13)17-12/h3-8H,9H2,1-2H3,(H,20,21)

InChI key: InChIKey=FDFSWSNDSXVJNV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(CN3C(C)=CC(C)=N3)C1)C=CC=C2

Synonyms:

• 4-Quinolinecarboxylic acid, 2-[(3,5-dimethyl-1H-pyrazol-1-yl)methyl]-
• 2-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]-4-quinolinecarboxylic acid

2-[(3,5-Dimethyl-1H-pyrazol-1-yl)methyl]quinoline-4-carboxylic Acid

CAS: 957035-26-6

Versatile small molecule scaffold

Formula: C₁₆H₁₅N₃O₂

Purity: Min. 95%

Molecular weight: 281.3 g/mol

Ref: 3D-HNB03526