CymitQuimica logo

CAS 957035-36-8

:

3-chloro-6-(4-iodo-1H-pyrazol-1-yl)pyridazine

Description:
3-Chloro-6-(4-iodo-1H-pyrazol-1-yl)pyridazine is a heterocyclic compound characterized by the presence of both a pyridazine and a pyrazole ring, which contribute to its unique chemical properties. The structure features a chlorine atom at the 3-position and an iodine atom at the 4-position of the pyrazole moiety, which can influence its reactivity and biological activity. This compound is likely to exhibit polar characteristics due to the halogen substituents, which can enhance its solubility in polar solvents. Additionally, the presence of halogens may impart interesting electronic properties, making it a potential candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery. Its synthesis and characterization would typically involve standard organic chemistry techniques, and it may be subject to further studies to evaluate its efficacy and safety in biological systems.
Formula:C7H4ClIN4
InChI:InChI=1S/C7H4ClIN4/c8-6-1-2-7(12-11-6)13-4-5(9)3-10-13/h1-4H
InChI key:ITGAMZMKSFYVNO-UHFFFAOYSA-N
SMILES:C1=CC(=NN=C1N2C=C(C=N2)I)Cl
Found 3 products.