CAS 957060-85-4
:(2-fluoro-4-methylsulfonyl-phenyl)boronic acid
Description:
(2-Fluoro-4-methylsulfonyl-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a fluorine atom and a methylsulfonyl group, which can influence its reactivity and solubility. The presence of the boronic acid group imparts acidic properties, allowing it to participate in reactions such as Suzuki coupling, a widely used method for forming carbon-carbon bonds. Additionally, the fluorine and methylsulfonyl substituents can enhance the compound's biological activity and selectivity in pharmaceutical applications. Overall, (2-fluoro-4-methylsulfonyl-phenyl)boronic acid is a versatile compound with significant potential in synthetic chemistry and drug development, owing to its unique structural features and reactivity.
Formula:C7H8BFO4S
InChI:InChI=1/C7H8BFO4S/c1-14(12,13)5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3
SMILES:CS(=O)(=O)c1ccc(c(c1)F)B(O)O
Synonyms:- 2-Fluoro-4-Methylsulfonylphenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Fluoro-4-(methylsulfonyl)phenylboronic acid
CAS:Formula:C7H8BFO4SPurity:98%Color and Shape:SolidMolecular weight:218.01042-Fluoro-4-(methylsulphonyl)benzeneboronic acid
CAS:2-Fluoro-4-(methylsulphonyl)benzeneboronic acidFormula:C7H8BFO4SPurity:95%Color and Shape: white solidMolecular weight:218.01g/mol(2-Fluoro-4-methylsulfonylphenyl)boronic acid
CAS:2-Fluoro-4-methylsulfonylphenyl)boronic acid is a fine chemical that is useful as a scaffold for the production of other compounds. It can be used as a versatile building block in organic synthesis, and is often used as an intermediate or research chemical. 2-Fluoro-4-methylsulfonylphenyl)boronic acid has been shown to react with many different types of compounds, making it a valuable reagent. This compound is also known for its high quality, which makes it an excellent choice for use in reactions that require speciality chemicals.Formula:C7H8BFO4SPurity:Min. 95%Color and Shape:White PowderMolecular weight:218.01 g/mol



