CAS 957060-85-4

(2-fluoro-4-methylsulfonyl-phenyl)boronic acid

Description:

(2-Fluoro-4-methylsulfonyl-phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a fluorine atom and a methylsulfonyl group, which can influence its reactivity and solubility. The presence of the boronic acid group imparts acidic properties, allowing it to participate in reactions such as Suzuki coupling, a widely used method for forming carbon-carbon bonds. Additionally, the fluorine and methylsulfonyl substituents can enhance the compound's biological activity and selectivity in pharmaceutical applications. Overall, (2-fluoro-4-methylsulfonyl-phenyl)boronic acid is a versatile compound with significant potential in synthetic chemistry and drug development, owing to its unique structural features and reactivity.

Formula: C₇H₈BFO₄S

InChI: InChI=1/C7H8BFO4S/c1-14(12,13)5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3

SMILES: CS(=O)(=O)c1ccc(c(c1)F)B(O)O

Synonyms:

• 2-Fluoro-4-Methylsulfonylphenylboronic Acid

2-Fluoro-4-(methylsulfonyl)phenylboronic acid

CAS: 957060-85-4

Formula: C₇H₈BFO₄S

Purity: 98%

Molecular weight: 218.01

Ref: 10-F220210

2-Fluoro-4-(methylsulfonyl)phenylboronic acid

CAS: 957060-85-4

Formula: C₇H₈BFO₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 218.0104

Ref: IN-DA003H96

2-Fluoro-4-(methylsulphonyl)benzeneboronic acid

CAS: 957060-85-4

2-Fluoro-4-(methylsulphonyl)benzeneboronic acid

Formula: C₇H₈BFO₄S

Purity: 95%

Color and Shape: white solid

Molecular weight: 218.01g/mol

Ref: 54-PC7122

(2-Fluoro-4-methylsulfonylphenyl)boronic acid

CAS: 957060-85-4

2-Fluoro-4-methylsulfonylphenyl)boronic acid is a fine chemical that is useful as a scaffold for the production of other compounds. It can be used as a versatile building block in organic synthesis, and is often used as an intermediate or research chemical. 2-Fluoro-4-methylsulfonylphenyl)boronic acid has been shown to react with many different types of compounds, making it a valuable reagent. This compound is also known for its high quality, which makes it an excellent choice for use in reactions that require speciality chemicals.

Formula: C₇H₈BFO₄S

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 218.01 g/mol

Ref: 3D-FF105553