CymitQuimica logo

CAS 957061-05-1

:

Benzoic acid,3-borono-5-chloro-

Description:
Benzoic acid, 3-borono-5-chloro- is an organic compound characterized by the presence of a benzoic acid moiety substituted with both a boron group and a chlorine atom. The compound features a boronic acid functional group, which is known for its reactivity in various organic synthesis applications, particularly in Suzuki coupling reactions. The chlorine atom introduces additional reactivity and can serve as a leaving group in nucleophilic substitution reactions. This compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure suggests potential applications in medicinal chemistry and materials science, particularly in the development of pharmaceuticals or agrochemicals. The presence of both boron and chlorine atoms can also influence its electronic properties, making it a candidate for further functionalization or incorporation into larger molecular frameworks. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C7H6BClO4
InChI:InChI=1S/C7H6BClO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3,12-13H,(H,10,11)
InChI key:DLAUXSOHALWWDR-UHFFFAOYSA-N
SMILES:B(C1=CC(=CC(=C1)Cl)C(=O)O)(O)O
Synonyms:
  • 3-Carboxy-5-chlorophenylboronic acid
Found 4 products.