CymitQuimica logo

CAS 957062-74-7

:

2-Bromo-N-ethyl-4-(trifluoromethoxy)benzenesulfonamide

Description:
2-Bromo-N-ethyl-4-(trifluoromethoxy)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of the bromine atom and the trifluoromethoxy group contributes to its unique reactivity and potential applications in medicinal chemistry. This compound features a benzene ring substituted with a sulfonamide group, which enhances its solubility in polar solvents and may influence its biological activity. The trifluoromethoxy group is particularly notable for imparting lipophilicity and may enhance the compound's ability to penetrate biological membranes. Additionally, the ethyl group attached to the nitrogen atom of the sulfonamide can affect the compound's pharmacokinetics and binding affinity to biological targets. Overall, 2-Bromo-N-ethyl-4-(trifluoromethoxy)benzenesulfonamide is of interest in research for its potential applications in drug development and as a tool in chemical biology, although specific biological activities and mechanisms would require further investigation.
Formula:C9H9BrF3NO3S
InChI:InChI=1S/C9H9BrF3NO3S/c1-2-14-18(15,16)8-4-3-6(5-7(8)10)17-9(11,12)13/h3-5,14H,2H2,1H3
InChI key:InChIKey=MTKFSLMOTTXCNW-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(Br)=C(S(NCC)(=O)=O)C=C1
Synonyms:
  • Benzenesulfonamide, 2-bromo-N-ethyl-4-(trifluoromethoxy)-
  • 2-Bromo-N-ethyl-4-(trifluoromethoxy)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.