CymitQuimica logo

CAS 957062-76-9

:

2-Bromo-N-butyl-4-(trifluoromethoxy)benzenesulfonamide

Description:
2-Bromo-N-butyl-4-(trifluoromethoxy)benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a bromine atom, a butyl group, and a trifluoromethoxy group attached to a benzenesulfonamide moiety. This compound features a sulfonamide functional group, which is known for its ability to form hydrogen bonds and participate in various chemical reactions, making it useful in medicinal chemistry. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity, potentially affecting its solubility and permeability in biological systems. The bromine atom can serve as a site for further chemical modifications, allowing for the synthesis of derivatives with varied properties. Overall, this compound may exhibit interesting pharmacological activities, making it a candidate for research in drug development. Its specific applications and behavior would depend on its interactions with biological targets and its stability under various conditions.
Formula:C11H13BrF3NO3S
InChI:InChI=1S/C11H13BrF3NO3S/c1-2-3-6-16-20(17,18)10-5-4-8(7-9(10)12)19-11(13,14)15/h4-5,7,16H,2-3,6H2,1H3
InChI key:InChIKey=RJZRYTZXGFVGDS-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(Br)=C(S(NCCCC)(=O)=O)C=C1
Synonyms:
  • Benzenesulfonamide, 2-bromo-N-butyl-4-(trifluoromethoxy)-
  • 2-Bromo-N-butyl-4-(trifluoromethoxy)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.