CAS 957062-77-0

4-Bromo-1-[(2-bromophenyl)sulfonyl]-1H-pyrazole

Description:

4-Bromo-1-[(2-bromophenyl)sulfonyl]-1H-pyrazole is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position of the pyrazole ring contributes to its reactivity and potential applications in various chemical reactions. Additionally, the compound features a sulfonyl group attached to a 2-bromophenyl moiety, enhancing its electrophilic properties and solubility in organic solvents. This structure suggests potential utility in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both bromine and sulfonyl functionalities, which can influence biological activity. The compound's molecular interactions may be further explored for applications in agrochemicals or as intermediates in organic synthesis. As with many brominated compounds, considerations regarding environmental impact and safety are essential, particularly in terms of handling and disposal. Overall, 4-Bromo-1-[(2-bromophenyl)sulfonyl]-1H-pyrazole represents a versatile building block in synthetic organic chemistry.

Formula: C₉H₆Br₂N₂O₂S

InChI: InChI=1S/C9H6Br2N2O2S/c10-7-5-12-13(6-7)16(14,15)9-4-2-1-3-8(9)11/h1-6H

InChI key: InChIKey=SWTMIZJXKCERLX-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(Br)C=CC=C1)N2C=C(Br)C=N2

Synonyms:

• 1H-Pyrazole, 4-bromo-1-[(2-bromophenyl)sulfonyl]-
• 4-Bromo-1-(2-Bromophenyl)Sulfonyl-Pyrazole
• 4-Bromo-1-[(2-bromophenyl)sulfonyl]-1H-pyrazole

4-Bromo-1-(2-bromophenylsulfonyl)-1H-pyrazole

CAS: 957062-77-0

Formula: C₉H₆Br₂N₂O₂S

Molecular weight: 366.0291

Ref: IN-DA003KUF

4-Bromo-1-[(2-bromophenyl)sulphonyl]-1H-pyrazole

CAS: 957062-77-0

4-Bromo-1-[(2-bromophenyl)sulphonyl]-1H-pyrazole

Purity: ≥95%

Molecular weight: 366.03g/mol

Ref: 54-OR59377