CAS 957062-78-1
:3-bromo-N,N-dipropyl-5-(trifluoromethyl)benzenesulfonamide
Description:
3-Bromo-N,N-dipropyl-5-(trifluoromethyl)benzenesulfonamide is a chemical compound characterized by its complex structure, which includes a sulfonamide functional group, a bromine atom, and a trifluoromethyl group attached to a benzene ring. The presence of the sulfonamide group indicates potential applications in medicinal chemistry, as sulfonamides are known for their antibacterial properties. The bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its biological activity. The trifluoromethyl group is notable for its ability to increase lipophilicity and metabolic stability, making the compound potentially useful in drug design. Additionally, the dipropyl substituents contribute to the overall hydrophobic character of the molecule, which may affect its solubility and interaction with biological targets. Overall, this compound's unique combination of functional groups suggests it could be of interest in pharmaceutical research, particularly in the development of new therapeutic agents.
Formula:C13H17BrF3NO2S
InChI:InChI=1/C13H17BrF3NO2S/c1-3-5-18(6-4-2)21(19,20)12-8-10(13(15,16)17)7-11(14)9-12/h7-9H,3-6H2,1-2H3
InChI key:InChIKey=IUJYPGDHDNNWCH-UHFFFAOYSA-N
SMILES:CCCN(CCC)S(=O)(=O)c1cc(cc(c1)Br)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N,N-Dipropyl 3-bromo-5-trifluoromethylbenzenesulfonamide
CAS:Formula:C13H17BrF3NO2SMolecular weight:388.24383-Bromo-N,N-dipropyl-5-(trifluoromethyl)benzenesulphonamide
CAS:<p>3-Bromo-N,N-dipropyl-5-(trifluoromethyl)benzenesulphonamide</p>Molecular weight:388.24g/mol


