CAS 957062-79-2
:2-Bromo-N-cyclopropyl-4-(trifluoromethoxy)benzenesulfonamide
Description:
2-Bromo-N-cyclopropyl-4-(trifluoromethoxy)benzenesulfonamide is a chemical compound characterized by its unique structural features, which include a bromine atom, a cyclopropyl group, and a trifluoromethoxy substituent attached to a benzenesulfonamide core. This compound is typically classified as an aromatic sulfonamide, which often exhibits properties such as high stability and solubility in organic solvents. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The bromine atom can serve as a site for further chemical modifications, while the cyclopropyl moiety may impart unique steric and electronic properties. Overall, this compound's characteristics suggest potential applications in medicinal chemistry, particularly in the development of targeted therapies or as a building block for more complex molecules. Its specific interactions and reactivity would depend on the context of its use, including the biological systems or chemical reactions it is involved in.
Formula:C10H9BrF3NO3S
InChI:InChI=1S/C10H9BrF3NO3S/c11-8-5-7(18-10(12,13)14)3-4-9(8)19(16,17)15-6-1-2-6/h3-6,15H,1-2H2
InChI key:InChIKey=DLYQRSNWDOGOQK-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=CC(Br)=C(S(NC2CC2)(=O)=O)C=C1
Synonyms:- 2-Bromo-N-cyclopropyl-4-(trifluoromethoxy)benzenesulfonamide
- Benzenesulfonamide, 2-bromo-N-cyclopropyl-4-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
N-Cyclopropyl 2-bromo-4-trifluoromethoxybenzenesulfonamide
CAS:Formula:C10H9BrF3NO3SMolecular weight:360.14762-Bromo-N-cyclopropyl-4-(trifluoromethoxy)benzenesulphonamide
CAS:<p>2-Bromo-N-cyclopropyl-4-(trifluoromethoxy)benzenesulphonamide</p>Molecular weight:360.15g/mol

