CAS 957062-80-5
:B-[2-[(4-Methoxyphenyl)methoxy]phenyl]boronic acid
Description:
B-[2-[(4-Methoxyphenyl)methoxy]phenyl]boronic acid, with the CAS number 957062-80-5, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a biphenyl structure. This compound typically exhibits properties such as solubility in organic solvents and moderate stability under standard conditions. The methoxy groups enhance its lipophilicity and may influence its reactivity and interactions in various chemical environments. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and as intermediates in the synthesis of complex molecules. Additionally, the presence of the methoxyphenyl moieties can impart specific electronic and steric properties, which may affect the compound's reactivity and potential applications in catalysis or as a ligand in coordination chemistry. Overall, this compound represents a versatile building block in organic synthesis and materials science.
Formula:C14H15BO4
InChI:InChI=1S/C14H15BO4/c1-18-12-8-6-11(7-9-12)10-19-14-5-3-2-4-13(14)15(16)17/h2-9,16-17H,10H2,1H3
InChI key:InChIKey=YVWFATUNDBQXOZ-UHFFFAOYSA-N
SMILES:O(CC1=CC=C(OC)C=C1)C2=C(B(O)O)C=CC=C2
Synonyms:- [2-[(4-Methoxyphenyl)methoxy]phenyl]boronic acid
- (2-((4-Methoxybenzyl)oxy)phenyl)boronic acid
- Boronic acid, B-[2-[(4-methoxyphenyl)methoxy]phenyl]-
- B-[2-[(4-Methoxyphenyl)methoxy]phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
