CymitQuimica logo

CAS 957062-92-9

:

ethyl 6,7-dichloro-3-(trifluoromethyl)-1,4-dihydroquinoxaline-2-carboxylate

Description:
Ethyl 6,7-dichloro-3-(trifluoromethyl)-1,4-dihydroquinoxaline-2-carboxylate is a synthetic organic compound characterized by its complex structure, which includes a quinoxaline core, dichloro substituents, and a trifluoromethyl group. This compound typically exhibits a range of chemical properties, including moderate solubility in organic solvents and potential reactivity due to the presence of halogen atoms, which can participate in nucleophilic substitution reactions. The ethyl ester functional group contributes to its reactivity and may influence its biological activity. The presence of the trifluoromethyl group often enhances lipophilicity, potentially affecting the compound's pharmacokinetics and interactions with biological targets. Additionally, the dichloro substituents may impart unique electronic properties, making this compound of interest in medicinal chemistry and material science. Its specific applications and biological activities would depend on further studies, but compounds of this nature are often explored for their potential as pharmaceuticals or agrochemicals.
Formula:C12H9Cl2F3N2O2
InChI:InChI=1/C12H9Cl2F3N2O2/c1-2-21-11(20)9-10(12(15,16)17)19-8-4-6(14)5(13)3-7(8)18-9/h3-4,18-19H,2H2,1H3
SMILES:CCOC(=O)c1c(C(F)(F)F)[nH]c2cc(c(cc2[nH]1)Cl)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.