CymitQuimica logo

CAS 957062-98-5

:

[4-[[4-(trifluoromethoxy)phenyl]sulfamoyl]phenyl]boronic acid

Description:
[4-[[4-(Trifluoromethoxy)phenyl]sulfamoyl]phenyl]boronic acid, with the CAS number 957062-98-5, is a boronic acid derivative characterized by its unique structural features, including a boron atom bonded to a phenyl group and a sulfamoyl moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including drug development and organic synthesis. The presence of the trifluoromethoxy group enhances its lipophilicity and may influence its biological activity. Additionally, the compound may exhibit solubility in polar organic solvents, and its acidic nature allows it to participate in acid-base reactions. Its potential applications could extend to medicinal chemistry, particularly in the design of inhibitors for specific biological targets. Overall, this compound represents a valuable tool in both synthetic and medicinal chemistry due to its functional groups and reactivity.
Formula:C13H11BF3NO5S
InChI:InChI=1/C13H11BF3NO5S/c15-13(16,17)23-11-5-3-10(4-6-11)18-24(21,22)12-7-1-9(2-8-12)14(19)20/h1-8,18-20H
SMILES:c1cc(ccc1B(O)O)S(=O)(=O)Nc1ccc(cc1)OC(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.