CymitQuimica logo

CAS 957065-85-9

:

2-Ethoxy-5-methoxyphenylboronic acid

Description:
2-Ethoxy-5-methoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both ethoxy and methoxy groups. This compound typically exhibits a white to off-white solid appearance and is soluble in polar organic solvents due to the presence of the ether and methoxy groups, which enhance its solubility. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the ethoxy and methoxy substituents can influence the compound's reactivity, stability, and interaction with biological systems. Additionally, this compound may serve as a building block in the synthesis of more complex molecules or as a reagent in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is widely utilized in the formation of carbon-carbon bonds. Overall, 2-Ethoxy-5-methoxyphenylboronic acid is a versatile compound with significant utility in chemical research and development.
Formula:C9H13BO4
InChI:InChI=1/C9H13BO4/c1-3-14-9-5-4-7(13-2)6-8(9)10(11)12/h4-6,11-12H,3H2,1-2H3
InChI key:QZURUWKQPQTXPR-UHFFFAOYSA-N
SMILES:CCOc1ccc(cc1B(O)O)OC
Synonyms:
  • 2-Ethoxy-5-methoxybenzeneboronic acid
Found 4 products.