CAS 957065-88-2

2-(3-Bromo-phenyl)-5-ethyl-[1,3,4]oxadiazole

Description:

2-(3-Bromo-phenyl)-5-ethyl-[1,3,4]oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. The compound features a bromophenyl group at one position and an ethyl substituent at another, contributing to its unique chemical properties. The bromine atom enhances the compound's reactivity and can influence its biological activity, making it of interest in medicinal chemistry. The oxadiazole moiety is known for its potential applications in pharmaceuticals, agrochemicals, and materials science due to its ability to participate in various chemical reactions and interactions. Additionally, the presence of the ethyl group can affect the compound's solubility and lipophilicity, which are important factors in drug design. Overall, this compound's structural features suggest potential utility in various chemical and biological applications, warranting further investigation into its properties and effects.

Formula: C₁₀H₉BrN₂O

InChI: InChI=1/C10H9BrN2O/c1-2-9-12-13-10(14-9)7-4-3-5-8(11)6-7/h3-6H,2H2,1H3

SMILES: CCc1nnc(c2cccc(c2)Br)o1

Synonyms:

• 2-(3-Bromophenyl)-5-Ethyl-1,3,4-Oxadiazole

2-(3-Bromophenyl)-5-ethyl-1,3,4-oxadiazole

CAS: 957065-88-2

Formula: C₁₀H₉BrN₂O

Molecular weight: 253.0953

Ref: IN-DA006BMS

2-(3-Bromophenyl)-5-ethyl-1,3,4-oxadiazole

CAS: 957065-88-2

2-(3-Bromophenyl)-5-ethyl-1,3,4-oxadiazole

Purity: ≥95%

Molecular weight: 253.10g/mol

Ref: 54-OR59334