CAS 957065-89-3
:1-(2,3-Dimethyl-phenyl)-pyrrolidine
Description:
1-(2,3-Dimethyl-phenyl)-pyrrolidine, identified by its CAS number 957065-89-3, is an organic compound characterized by a pyrrolidine ring substituted with a 2,3-dimethylphenyl group. This structure imparts specific physical and chemical properties to the compound. Typically, it is a colorless to pale yellow liquid or solid, depending on its purity and temperature. The presence of the pyrrolidine moiety suggests that it may exhibit basic properties due to the nitrogen atom in the ring, which can participate in hydrogen bonding and influence solubility in various solvents. The dimethylphenyl substituent can enhance lipophilicity, potentially affecting the compound's biological activity and interactions with other molecules. Additionally, this compound may be of interest in medicinal chemistry for its potential pharmacological properties, although specific biological activities would require further investigation. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C12H17N
InChI:InChI=1/C12H17N/c1-10-6-5-7-12(11(10)2)13-8-3-4-9-13/h5-7H,3-4,8-9H2,1-2H3
SMILES:Cc1cccc(c1C)N1CCCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(2,3-Dimethylphenyl)pyrrolidine
CAS:<p>1-(2,3-Dimethylphenyl)pyrrolidine</p>Molecular weight:175.27g/mol

