CymitQuimica logo

CAS 957065-96-2

:

2-(3-Bromophenyl)-5-(1,1-dimethylethyl)-1,3,4-oxadiazole

Description:
2-(3-Bromophenyl)-5-(1,1-dimethylethyl)-1,3,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring. The compound features a bromophenyl group at one position and a tert-butyl group at another, contributing to its unique chemical properties. The bromine atom enhances the compound's reactivity and potential for substitution reactions, while the tert-butyl group provides steric hindrance, influencing its interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions. Additionally, the presence of the oxadiazole moiety often imparts interesting electronic properties, which can be exploited in materials science and organic electronics. Overall, 2-(3-Bromophenyl)-5-(1,1-dimethylethyl)-1,3,4-oxadiazole is a versatile compound with potential applications in various fields, including medicinal chemistry and materials development.
Formula:C12H13BrN2O
InChI:InChI=1S/C12H13BrN2O/c1-12(2,3)11-15-14-10(16-11)8-5-4-6-9(13)7-8/h4-7H,1-3H3
InChI key:InChIKey=PJHHEWRHJXZUJR-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1OC(=NN1)C2=CC(Br)=CC=C2
Synonyms:
  • 1,3,4-Oxadiazole, 2-(3-bromophenyl)-5-(1,1-dimethylethyl)-
  • 2-(3-Bromo-phenyl)-5-tert-butyl-[1,3,4]oxadiazole
  • 2-(3-Bromophenyl)-5-(1,1-dimethylethyl)-1,3,4-oxadiazole
  • 2-(3-Bromophenyl)-5-(tert-butyl)-1,3,4-oxadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.