CAS 957066-12-5

N-[(4,4-dimethylcyclohexylidene)amino]-2,4,6-trimethyl-benzenesulfonamide

Description:

N-[(4,4-dimethylcyclohexylidene)amino]-2,4,6-trimethyl-benzenesulfonamide, identified by its CAS number 957066-12-5, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The structure features a sulfonamide moiety attached to a trimethyl-substituted benzene ring, indicating potential hydrophobic interactions due to the bulky methyl groups. The presence of the 4,4-dimethylcyclohexylidene group suggests steric hindrance, which may influence the compound's reactivity and solubility. This compound may exhibit unique properties such as enhanced lipophilicity, which can affect its bioavailability and interaction with biological systems. Additionally, the presence of the amino group indicates potential for hydrogen bonding, which could play a role in its biological activity. Overall, this compound's characteristics suggest it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₇H₂₆N₂O₂S

InChI: InChI=1/C17H26N2O2S/c1-12-10-13(2)16(14(3)11-12)22(20,21)19-18-15-6-8-17(4,5)9-7-15/h10-11,19H,6-9H2,1-5H3

SMILES: Cc1cc(C)c(c(C)c1)S(=O)(=O)NN=C1CCC(C)(C)CC1

N'-(4,4-DiMethylcyclohexylidene)-2,4,6-triMethylbenzenesulfonohydrazide

CAS: 957066-12-5

Formula: C₁₇H₂₆N₂O₂S

Color and Shape: Solid

Molecular weight: 322.4655

Ref: IN-DA003SBH

N'-(4,4-Dimethylcyclohexylidene)-2,4,6-trimethylbenzenesulphonohydrazide

CAS: 957066-12-5

N'-(4,4-Dimethylcyclohexylidene)-2,4,6-trimethylbenzenesulphonohydrazide

Purity: ≥95%

Molecular weight: 322.47g/mol

Ref: 54-OR59405