CAS 95709-82-3

N-(4-Amino-5-chloro-2-hydroxyphenyl)-3,4-dichlorobenzamide

Description:

N-(4-Amino-5-chloro-2-hydroxyphenyl)-3,4-dichlorobenzamide, with the CAS number 95709-82-3, is a chemical compound characterized by its complex structure, which includes an amine group, multiple chlorine substituents, and a hydroxyl group. This compound is typically classified as an aromatic amide due to the presence of the benzamide functional group. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of therapeutic agents, owing to the presence of functional groups that can engage in hydrogen bonding and other interactions. The chlorine atoms contribute to its lipophilicity and may influence its biological activity. Additionally, the hydroxyl group can enhance solubility in polar solvents. The compound's synthesis and reactivity may be of interest in medicinal chemistry, especially in the context of designing compounds with specific biological activities. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.

Formula: C₁₃H₉Cl₃N₂O₂

InChI: InChI=1S/C13H9Cl3N2O2/c14-7-2-1-6(3-8(7)15)13(20)18-11-4-9(16)10(17)5-12(11)19/h1-5,19H,17H2,(H,18,20)

InChI key: InChIKey=YEMGDMMNWKZAAS-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC(Cl)=C(Cl)C=C1)C2=C(O)C=C(N)C(Cl)=C2

Synonyms:

• benzamide, N-(4-amino-5-chloro-2-hydroxyphenyl)-3,4-dichloro-
• N-(4-Amino-5-chloro-2-hydroxyphenyl)-3,4-dichlorobenzamide
• N-(4-Amino-5-chloro-2-hydroxyphenyl)-3,4-dichlorobenzamide