CAS 957103-98-9

B-[4-(2-Aminophenoxy)phenyl]boronic acid

Description:

B-[4-(2-Aminophenoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical applications, including organic synthesis and medicinal chemistry. The compound features a biphenyl structure with an amino group and a phenoxy group, contributing to its potential biological activity. Its boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. This compound may exhibit properties such as solubility in polar organic solvents and moderate stability under standard laboratory conditions. Additionally, due to the presence of the amino group, it may engage in hydrogen bonding and other interactions, influencing its reactivity and potential applications in drug development or as a building block in materials science. As with many boronic acids, it is essential to handle this compound with care, considering its reactivity and potential environmental impact.

Formula: C₁₂H₁₂BNO₃

InChI: InChI=1S/C12H12BNO3/c14-11-3-1-2-4-12(11)17-10-7-5-9(6-8-10)13(15)16/h1-8,15-16H,14H2

InChI key: InChIKey=FYEZAQBUIMTLIM-UHFFFAOYSA-N

SMILES: O(C1=CC=C(B(O)O)C=C1)C2=C(N)C=CC=C2

Synonyms:

• B-[4-(2-Aminophenoxy)phenyl]boronic acid
• Boronic acid, B-[4-(2-aminophenoxy)phenyl]-
• [4-(2-Aminophenoxy)phenyl]boronic acid

[4-(2-Aminophenoxy)phenyl]boronic acid

CAS: 957103-98-9

Formula: C₁₂H₁₂BNO₃

Molecular weight: 229.0396

Ref: IN-DA00IJDU