CymitQuimica logo

CAS 957120-28-4

:

6-Bromo-2-chloro-3-methylphenylboronic acid

Description:
6-Bromo-2-chloro-3-methylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. The compound features a phenyl ring substituted with both a bromine and a chlorine atom, as well as a methyl group, which can influence its reactivity and solubility. The presence of these halogen substituents can enhance the electrophilicity of the aromatic system, facilitating nucleophilic attack in synthetic applications. Additionally, the boronic acid group imparts water solubility, allowing for its use in aqueous environments. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and organic synthesis. Its unique structure and functional groups make it a valuable intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling, as with all chemical substances.
Formula:C7H7BBrClO2
InChI:InChI=1S/C7H7BBrClO2/c1-4-2-3-5(9)6(7(4)10)8(11)12/h2-3,11-12H,1H3
InChI key:PULIDPRGYYCQEZ-UHFFFAOYSA-N
SMILES:B(C1=C(C=CC(=C1Cl)C)Br)(O)O
Synonyms:
  • Boronic acid, B-(6-bromo-2-chloro-3-methylphenyl)-
  • 6-BroMo-2-chL
  • 6-Bromo-2-chloro-3-methylphenylboronic acid
Found 4 products.