CymitQuimica logo

CAS 957120-34-2

:

Benzoic acid,5-amino-4-chloro-2-fluoro-, hydrochloride (1:1)

Description:
Benzoic acid, 5-amino-4-chloro-2-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group, a chlorine atom, and a fluorine atom. The presence of these substituents influences its chemical reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The amino group can participate in hydrogen bonding, which may affect its biological activity and interaction with other molecules. The chlorine and fluorine substituents can impart unique electronic properties, potentially influencing the compound's pharmacological profile. This compound may be of interest in medicinal chemistry for its potential therapeutic applications, and its synthesis and characterization would involve standard organic chemistry techniques. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C7H5ClFNO2ClH
InChI:InChI=1S/C7H5ClFNO2.ClH/c8-4-2-5(9)3(7(11)12)1-6(4)10;/h1-2H,10H2,(H,11,12);1H
InChI key:FJPIOMIGSVACGO-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1N)Cl)F)C(=O)O.Cl
Synonyms:
  • 5-Amino-4-chloro-2-fluorobenzoic acid, HCl
Found 1 products.