CAS 957120-39-7

Imidazo[1,2-a]pyridine, 8-bromo-6-chloro-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine, 8-bromo-6-chloro-, hydrochloride (1:1) is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 8 and 6 positions, respectively, enhances its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structure allows for potential interactions with biological targets, and it may be investigated for its role in drug development. Additionally, the presence of halogens can influence the compound's electronic properties, stability, and lipophilicity, which are critical factors in drug design. Overall, Imidazo[1,2-a]pyridine derivatives are known for their diverse biological activities, including antimicrobial and anticancer properties.

Formula: C₇H₄BrClN₂·ClH

InChI: InChI=1S/C7H4BrClN2.ClH/c8-6-3-5(9)4-11-2-1-10-7(6)11;/h1-4H;1H

InChI key: InChIKey=BRMLRSUISXDAMX-UHFFFAOYSA-N

SMILES: BrC=1C=2N(C=C(Cl)C1)C=CN2.Cl

Synonyms:

• 8-Bromo-6-chloroimidazo[1,2-a]pyridine hydrochloride
• Imidazo[1,2-a]pyridine, 8-bromo-6-chloro-, hydrochloride (1:1)

8-Bromo-6-chloroimidazo[1,2-a]pyridine, HCl

CAS: 957120-39-7

Formula: C₇H₅BrCl₂N₂

Purity: 98%

Molecular weight: 267.9380

Ref: IN-DA00IJDY

8-Bromo-6-chloroimidazo[1,2-a]pyridine hydrochloride

CAS: 957120-39-7

8-Bromo-6-chloroimidazo[1,2-a]pyridine hydrochloride

Purity: ≥95%

Color and Shape: Powder

Molecular weight: 267.94g/mol

Ref: 54-OR11667

8-Bromo-6-chloroimidazo[1,2-a]pyridinehydrochloride

CAS: 957120-39-7

Formula: C₇H₅BrCl₂N₂

Purity: 95.0%

Molecular weight: 267.94

Ref: 10-F212472