CAS 957120-69-3

Benzenamine, 2-bromo-N-methyl-, hydrochloride (1:1)

Description:

Benzenamine, 2-bromo-N-methyl-, hydrochloride (1:1), also known as 2-bromo-N-methylbenzenamine hydrochloride, is an organic compound characterized by its aromatic amine structure. It features a bromine substituent at the second position of the benzene ring and a methyl group attached to the nitrogen atom of the amine. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates handling in laboratory settings. The presence of the bromine atom introduces notable reactivity, making it useful in various synthetic applications, including the preparation of pharmaceuticals and agrochemicals. The hydrochloride form is often more stable and easier to store compared to its free base counterpart. In terms of safety, like many amines and halogenated compounds, it may pose health risks, including potential toxicity and irritant properties, necessitating appropriate safety measures during handling. Overall, this compound is significant in organic synthesis and research due to its functional groups and reactivity.

Formula: C₇H₈BrN·ClH

InChI: InChI=1S/C7H8BrN.ClH/c1-9-7-5-3-2-4-6(7)8;/h2-5,9H,1H3;1H

InChI key: InChIKey=BXUFFBPLMGZFJO-UHFFFAOYSA-N

SMILES: N(C)C1=C(Br)C=CC=C1.Cl

Synonyms:

• Benzenamine, 2-bromo-N-methyl-, hydrochloride (1:1)
• 2-Bromo-N-methylaniline hydrochloride

2-Bromo-N-methylaniline, HCl

CAS: 957120-69-3

Formula: C₇H₉BrClN

Molecular weight: 222.5101

Ref: IN-DA00IJE4

2-Bromo-N-methylaniline hydrochloride

CAS: 957120-69-3

2-Bromo-N-methylaniline hydrochloride

Purity: ≥95%

Molecular weight: 222.51g/mol

Ref: 54-OR11598

2-Bromo-N-methylaniline hydrochloride

CAS: 957120-69-3

Versatile small molecule scaffold

Formula: C₇H₉BrClN

Purity: Min. 95%

Molecular weight: 222.51 g/mol

Ref: 3D-HNB12069