CAS 957120-75-1

Imidazo[1,2-a]pyridine-7-carboxylic acid, ethyl ester, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine-7-carboxylic acid, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused imidazole and pyridine ring system. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The ethyl ester group contributes to its lipophilicity, enhancing its potential bioavailability. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its hydrochloride form indicates that it is a salt, which can influence its stability and solubility properties. As with many heterocyclic compounds, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it versatile for synthetic applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₁₀N₂O₂·ClH

InChI: InChI=1S/C10H10N2O2.ClH/c1-2-14-10(13)8-3-5-12-6-4-11-9(12)7-8;/h3-7H,2H2,1H3;1H

InChI key: InChIKey=TUOJCZGQKPRXPP-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC=2N(C=C1)C=CN2.Cl

Synonyms:

• Ethyl Imidazo[1,2-A]Pyridine-7-Carboxylate Hydrochloride
• Imidazo[1,2-a]pyridine-7-carboxylic acid, ethyl ester, hydrochloride (1:1)

Ethyl imidazo[1,2-a]pyridine-7-carboxylate, HCl

CAS: 957120-75-1

Formula: C₁₀H₁₁ClN₂O₂

Molecular weight: 226.6595

Ref: IN-DA00IJE5

Ethyl imidazo[1,2-a]pyridine-7-carboxylate hydrochloride

CAS: 957120-75-1

Ethyl imidazo[1,2-a]pyridine-7-carboxylate hydrochloride

Purity: ≥95%

Molecular weight: 226.66g/mol

Ref: 54-OR11575