CAS 957120-95-5

B-[4-[(1-Naphthalenylamino)sulfonyl]phenyl]boronic acid

Description:

B-[4-[(1-Naphthalenylamino)sulfonyl]phenyl]boronic acid, with the CAS number 957120-95-5, is a boronic acid derivative characterized by its unique structural features that include a boron atom bonded to a phenyl group and a sulfonamide moiety. This compound typically exhibits properties such as moderate solubility in polar organic solvents and can participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis and medicinal chemistry. The presence of the naphthalenylamino group enhances its potential for biological activity, making it a candidate for research in drug development. Additionally, boronic acids are known for their ability to form reversible covalent bonds with diols, which can be exploited in sensor applications and materials science. The compound's stability, reactivity, and functionalization potential make it a valuable substance in both academic and industrial chemistry contexts. Overall, its unique combination of functional groups contributes to its versatility in various chemical applications.

Formula: C₁₆H₁₄BNO₄S

InChI: InChI=1S/C16H14BNO4S/c19-17(20)13-8-10-14(11-9-13)23(21,22)18-16-7-3-5-12-4-1-2-6-15(12)16/h1-11,18-20H

InChI key: InChIKey=UOKSWRGMRNZXCO-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC=C(B(O)O)C=C1)C=2C3=C(C=CC2)C=CC=C3

Synonyms:

• B-[4-[(1-Naphthalenylamino)sulfonyl]phenyl]boronic acid
• Boronic acid, B-[4-[(1-naphthalenylamino)sulfonyl]phenyl]-

4-(N-Naphthalen-1-ylsulfamoyl)phenylboronic acid

CAS: 957120-95-5

Formula: C₁₆H₁₄BNO₄S

Purity: 96%

Color and Shape: Solid

Molecular weight: 327.1627

Ref: IN-DA003BU8

4-(Naphth-1-ylsulphamoyl)benzeneboronic acid

CAS: 957120-95-5

4-(Naphth-1-ylsulphamoyl)benzeneboronic acid

Purity: 96%

Molecular weight: 327.16g/mol

Ref: 54-OR11939

(4-(N-(Naphthalen-1-yl)sulfamoyl)phenyl)boronic acid

CAS: 957120-95-5

Formula: C₁₆H₁₄BNO₄S

Purity: 96%

Molecular weight: 327.16

Ref: 10-F213424