CAS 957120-99-9

B-[4-[[(4-Fluoro-3-methoxyphenyl)amino]sulfonyl]phenyl]boronic acid

Description:

B-[4-[[(4-Fluoro-3-methoxyphenyl)amino]sulfonyl]phenyl]boronic acid, identified by its CAS number 957120-99-9, is a boronic acid derivative characterized by its unique functional groups, which include a boronic acid moiety and a sulfonamide linkage. This compound typically exhibits properties such as moderate solubility in polar solvents and potential reactivity with diols, making it useful in various chemical applications, particularly in medicinal chemistry and organic synthesis. The presence of the fluorine atom and methoxy group on the aromatic ring can influence its electronic properties and biological activity. Additionally, boronic acids are known for their ability to form reversible covalent bonds with certain biomolecules, which can be exploited in drug design and development. Overall, this compound's structural features suggest it may have applications in targeted therapies or as a tool in chemical biology.

Formula: C₁₃H₁₃BFNO₅S

InChI: InChI=1S/C13H13BFNO5S/c1-21-13-8-10(4-7-12(13)15)16-22(19,20)11-5-2-9(3-6-11)14(17)18/h2-8,16-18H,1H3

InChI key: InChIKey=XNUBPWLAGSNZKR-UHFFFAOYSA-N

SMILES: S(NC1=CC(OC)=C(F)C=C1)(=O)(=O)C2=CC=C(B(O)O)C=C2

Synonyms:

• Boronic acid, B-[4-[[(4-fluoro-3-methoxyphenyl)amino]sulfonyl]phenyl]-
• B-[4-[[(4-Fluoro-3-methoxyphenyl)amino]sulfonyl]phenyl]boronic acid

4-(N-(4-Fluoro-3-methoxyphenyl)sulfamoyl)phenylboronic acid

CAS: 957120-99-9

Formula: C₁₃H₁₃BFNO₅S

Purity: 98%

Color and Shape: Solid

Molecular weight: 325.1204

Ref: IN-DA003BU6

4-[N-(4-Fluoro-3-methoxyphenyl)sulphamoyl]benzeneboronic acid

CAS: 957120-99-9

4-[N-(4-Fluoro-3-methoxyphenyl)sulphamoyl]benzeneboronic acid

Purity: 98%

Molecular weight: 325.12g/mol

Ref: 54-PC8084

(4-(N-(4-Fluoro-3-methoxyphenyl)sulfamoyl)phenyl)boronic acid

CAS: 957120-99-9

Formula: C₁₃H₁₃BFNO₅S

Purity: 98%

Molecular weight: 325.12

Ref: 10-F213411