CAS 957121-03-8

B,B′-[2,5-Bis(methoxymethyl)-1,4-phenylene]bis[boronic acid]

Description:

B,B′-[2,5-Bis(methoxymethyl)-1,4-phenylene]bis[boronic acid], identified by its CAS number 957121-03-8, is an organoboron compound characterized by the presence of two boronic acid functional groups attached to a biphenyl structure. This compound features methoxymethyl substituents that enhance its solubility and reactivity. Boronic acids are known for their ability to form reversible covalent bonds with diols, making them valuable in various applications, including organic synthesis, drug development, and materials science. The methoxymethyl groups contribute to the compound's stability and may influence its electronic properties. Typically, boronic acids can participate in Suzuki coupling reactions, which are essential for constructing complex organic molecules. Additionally, this compound may exhibit interesting properties in the context of sensor technology and catalysis due to its boron content. Overall, B,B′-[2,5-Bis(methoxymethyl)-1,4-phenylene]bis[boronic acid] represents a versatile building block in synthetic chemistry with potential applications in various fields.

Formula: C₁₀H₁₆B₂O₆

InChI: InChI=1S/C10H16B2O6/c1-17-5-7-3-10(12(15)16)8(6-18-2)4-9(7)11(13)14/h3-4,13-16H,5-6H2,1-2H3

InChI key: InChIKey=NFMLXZAULPLVSK-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(COC)C=C(B(O)O)C(COC)=C1

Synonyms:

• B,B′-[2,5-Bis(methoxymethyl)-1,4-phenylene]bis[boronic acid]
• Boronic acid, B,B′-[2,5-bis(methoxymethyl)-1,4-phenylene]bis-

2,5-Bis(methoxymethyl)-1,4-phenylenediboronic acid

CAS: 957121-03-8

Formula: C₁₀H₁₆B₂O₆

Molecular weight: 253.8524

Ref: IN-DA003FW5

2,5-Bis(methoxymethyl)benzene-1,4-diboronic acid

CAS: 957121-03-8

2,5-Bis(methoxymethyl)benzene-1,4-diboronic acid

Purity: ≥95%

Molecular weight: 253.85g/mol

Ref: 54-OR11926