CymitQuimica logo

CAS 957121-09-4

:

B-(2-Bromo-6-fluoro-3-methylphenyl)boronic acid

Description:
B-(2-Bromo-6-fluoro-3-methylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a substituted phenyl ring. This compound features a bromine atom and a fluorine atom on the aromatic ring, which can influence its reactivity and solubility. The presence of the boronic acid group allows for participation in Suzuki-Miyaura cross-coupling reactions, making it valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. The fluorine substituent can enhance the compound's electronic properties, while the bromine can serve as a leaving group in various chemical transformations. Additionally, the methyl group contributes to the steric and electronic environment of the molecule. Overall, this compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and the synthesis of complex organic molecules. Its unique structural features make it a versatile building block in synthetic organic chemistry.
Formula:C7H7BBrFO2
InChI:InChI=1S/C7H7BBrFO2/c1-4-2-3-5(10)6(7(4)9)8(11)12/h2-3,11-12H,1H3
InChI key:InChIKey=DJJQBIXFCLTFQS-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(Br)C(C)=CC=C1F
Synonyms:
  • B-(2-Bromo-6-fluoro-3-methylphenyl)boronic acid
  • Boronic acid, B-(2-bromo-6-fluoro-3-methylphenyl)-
Found 4 products.