CAS 957127-83-2
:1-tert-butyl 6-methyl 1H-indole-1,6-dicarboxylate
Description:
1-tert-butyl 6-methyl 1H-indole-1,6-dicarboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific derivative features a tert-butyl group and a methyl group attached to the indole core, along with two carboxylate ester functionalities. The presence of these substituents influences its physical and chemical properties, such as solubility, reactivity, and potential biological activity. Typically, compounds like this may exhibit interesting pharmacological properties, making them subjects of research in medicinal chemistry. The compound's molecular structure suggests it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Additionally, its CAS number, 957127-83-2, allows for easy identification and retrieval of information regarding its safety, handling, and regulatory status. Overall, 1-tert-butyl 6-methyl 1H-indole-1,6-dicarboxylate represents a unique structure with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C15H17NO4
InChI:InChI=1/C15H17NO4/c1-15(2,3)20-14(18)16-8-7-10-5-6-11(9-12(10)16)13(17)19-4/h5-9H,1-4H3
SMILES:CC(C)(C)OC(=O)n1ccc2ccc(cc12)C(=O)OC
Synonyms:- 1-tert-Butyl 6-methyl 1H-indole-1,6-dicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.