
CAS 957129-49-6
:5-(1-Methylethyl)-1H-pyrazole-3-carboxamide
Description:
5-(1-Methylethyl)-1H-pyrazole-3-carboxamide, identified by its CAS number 957129-49-6, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the isopropyl group (1-methylethyl) enhances its lipophilicity, which may influence its solubility and permeability in biological systems. Typically, compounds like this may exhibit various biological activities, making them of interest in pharmaceutical research. The specific properties, such as melting point, boiling point, and solubility, would depend on the compound's interactions with solvents and other substances. Additionally, its stability under different conditions, such as temperature and pH, is crucial for its application in various fields, including medicinal chemistry and agrochemicals. Overall, 5-(1-Methylethyl)-1H-pyrazole-3-carboxamide represents a class of compounds that may have significant implications in drug development and other chemical applications.
Formula:C7H11N3O
InChI:InChI=1S/C7H11N3O/c1-4(2)5-3-6(7(8)11)10-9-5/h3-4H,1-2H3,(H2,8,11)(H,9,10)
InChI key:InChIKey=QFGLCVUCLKAPKT-UHFFFAOYSA-N
SMILES:C(C)(C)C1=CC(C(N)=O)=NN1
Synonyms:- 1H-Pyrazole-3-carboxamide, 5-(1-methylethyl)-
- 5-(1-Methylethyl)-1H-pyrazole-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.