CAS 95716-71-5
:Pregna-4,6,9(11)-triene-21-carboxylic acid, 17-hydroxy-3-oxo-, γ-lactone, (17α)-
Description:
Pregna-4,6,9(11)-triene-21-carboxylic acid, 17-hydroxy-3-oxo-, γ-lactone, (17α)-, commonly known as a synthetic steroid, exhibits characteristics typical of steroid compounds, including a tetracyclic structure composed of four fused rings. This compound features a carboxylic acid functional group and a lactone, which contributes to its chemical reactivity and potential biological activity. The presence of hydroxyl and keto groups indicates that it may participate in hydrogen bonding, influencing its solubility and interaction with biological targets. As a derivative of progesterone, it may exhibit hormonal activity, potentially influencing reproductive processes. The stereochemistry, particularly the (17α)- configuration, is crucial for its biological function, as it can affect receptor binding and activity. This compound is primarily studied in the context of pharmacology and biochemistry, particularly for its potential therapeutic applications. Its CAS number, 95716-71-5, allows for precise identification in chemical databases, facilitating research and development in medicinal chemistry.
Formula:C22H26O3
InChI:InChI=1S/C22H26O3/c1-20-9-5-15(23)13-14(20)3-4-16-17(20)6-10-21(2)18(16)7-11-22(21)12-8-19(24)25-22/h3-4,6,13,16,18H,5,7-12H2,1-2H3/t16-,18+,20+,21+,22-/m1/s1
InChI key:InChIKey=MCNZISFQKMPWRJ-DOYHNPMNSA-N
SMILES:C[C@@]12[C@]3(CC[C@]1([C@]4(C(=CC2)[C@]5(C)C(C=C4)=CC(=O)CC5)[H])[H])OC(=O)CC3
Synonyms:- 17-Hydroxy-3-oxopregn-4,6,9-triene-21-carboxylic acid gamma-lactone
- 17α-Pregna-4,6,9(11)-triene-21-carboxylic acid, 17-hydroxy-3-oxo-, γ-lactone
- 17β-Hydroxy-4,6,9(11)-trien-3-one 21-carboxylic acid γ-lactone
- Pregna-4,6,9(11)-triene-21-carboxylic acid, 17-hydroxy-3-oxo-, γ-lactone, (17α)-
- Spiro[17H-cyclopenta[a]phenanthrene-17,2′(5′H)-furan], pregna-4,6,9(11)-triene-21-carboxylic acid deriv.
- Δ<sup>9-11</sup>-Canrenone
- Δ<sup>9</sup>-Canrenone
- Δ9-Canrenone
- Delta 9,11-canrenone
- Δ9-11-Canrenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.


