CAS 957187-26-7

Imidazo[1,2-a]pyridine, 8-bromo-5-methyl-

Description:

Imidazo[1,2-a]pyridine, 8-bromo-5-methyl- is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 8-position and a methyl group at the 5-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a planar structure, allowing for effective π-π stacking interactions, which can influence its behavior in biological systems and materials science. It may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-withdrawing nature of the bromine substituent. Additionally, imidazo[1,2-a]pyridines are known for their potential biological activities, making them of interest in medicinal chemistry. The compound's specific properties, such as melting point, boiling point, and spectral characteristics, can vary based on its environment and the presence of other functional groups. Overall, this compound represents a versatile scaffold for further chemical exploration and application in drug development and material science.

Formula: C₈H₇BrN₂

InChI: InChI=1S/C8H7BrN2/c1-6-2-3-7(9)8-10-4-5-11(6)8/h2-5H,1H3

InChI key: InChIKey=AWYVWBPDMGSBFG-UHFFFAOYSA-N

SMILES: BrC=1C=2N(C(C)=CC1)C=CN2

Synonyms:

• 8-Bromo-5-methylimidazo[1,2-a]pyridine
• Imidazo[1,2-a]pyridine, 8-bromo-5-methyl-

Imidazo[1,2-a]pyridine, 8-bromo-5-methyl-

CAS: 957187-26-7

Formula: C₈H₇BrN₂

Purity: 98%

Molecular weight: 211.0586

Ref: IN-DA01PJ9H

8-Bromo-5-methylimidazo[1,2-a]pyridine

CAS: 957187-26-7

8-Bromo-5-methylimidazo[1,2-a]pyridine

Purity: 98%

Molecular weight: 211.06g/mol

Ref: 54-OR93026

8-Bromo-5-methylimidazo[1,2-a]pyridine

CAS: 957187-26-7

Purity: 98%

Molecular weight: 211.0619965

Ref: 10-F762930