
CAS 957194-05-7
:1,2,3,4-Tetrahydro-7-iodo-1-(phenylmethyl)pyrido[2,3-b]pyrazine
Description:
1,2,3,4-Tetrahydro-7-iodo-1-(phenylmethyl)pyrido[2,3-b]pyrazine is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and a pyrazine moiety. The presence of the tetrahydro group indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring system. The iodine substituent at the 7-position contributes to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The phenylmethyl group enhances the lipophilicity of the molecule, which may influence its biological activity and interaction with various biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in drug discovery and development. Its specific properties, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups. Overall, the structural features of 1,2,3,4-Tetrahydro-7-iodo-1-(phenylmethyl)pyrido[2,3-b]pyrazine suggest potential utility in various chemical and biological applications.
Formula:C14H14IN3
InChI:InChI=1S/C14H14IN3/c15-12-8-13-14(17-9-12)16-6-7-18(13)10-11-4-2-1-3-5-11/h1-5,8-9H,6-7,10H2,(H,16,17)
InChI key:InChIKey=LAVZMEHRYKIOKS-UHFFFAOYSA-N
SMILES:C(N1C=2C(NCC1)=NC=C(I)C2)C3=CC=CC=C3
Synonyms:- 1,2,3,4-Tetrahydro-7-iodo-1-(phenylmethyl)pyrido[2,3-b]pyrazine
- 1-Benzyl-7-iodo-1H,2H,3H,4H-pyrido[2,3-b]pyrazine
- Pyrido[2,3-b]pyrazine, 1,2,3,4-tetrahydro-7-iodo-1-(phenylmethyl)-
- 1-Benzyl-7-iodo-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.