CymitQuimica logo

CAS 957198-20-8

:

1-(1-Bromoethyl)-2,4,5-trifluorobenzene

Description:
1-(1-Bromoethyl)-2,4,5-trifluorobenzene is an organic compound characterized by its unique structure, which includes a bromine atom and trifluoromethyl groups attached to a benzene ring. The presence of the bromine atom introduces reactivity, making it a potential intermediate in various chemical syntheses. The trifluoromethyl groups contribute to the compound's lipophilicity and can influence its electronic properties, enhancing its stability and reactivity in certain reactions. This compound is likely to be a colorless to pale yellow liquid or solid, depending on temperature and purity. It may exhibit moderate volatility and is expected to be soluble in organic solvents. Due to the presence of halogens, it may also have specific environmental and health considerations, necessitating careful handling. Its applications could span across pharmaceuticals, agrochemicals, and materials science, where it may serve as a building block for more complex molecules. As with all chemical substances, proper safety protocols should be followed when handling this compound.
Formula:C8H6BrF3
InChI:InChI=1S/C8H6BrF3/c1-4(9)5-2-7(11)8(12)3-6(5)10/h2-4H,1H3
InChI key:InChIKey=HHESEUKOVBJPJP-UHFFFAOYSA-N
SMILES:C(Br)(C)C1=C(F)C=C(F)C(F)=C1
Synonyms:
  • 1-(1-Bromoethyl)-2,4,5-trifluorobenzene
  • Benzene, 1-(1-bromoethyl)-2,4,5-trifluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.