CAS 957206-65-4
:1-methoxy-4-[(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)oxy]benzene
Description:
1-Methoxy-4-[(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)oxy]benzene, with CAS number 957206-65-4, is a fluorinated organic compound characterized by its unique structure that includes a methoxy group and a long perfluorinated alkyl chain. The presence of the methoxy group contributes to its solubility in organic solvents, while the perfluorinated segment enhances its hydrophobic properties and thermal stability. This compound is likely to exhibit low surface tension and high chemical resistance, making it suitable for applications in coatings, surfactants, and potentially in the development of advanced materials. Its fluorinated nature may also impart unique properties such as low friction and non-stick characteristics. However, the environmental impact and biocompatibility of such fluorinated compounds are subjects of ongoing research, given the concerns associated with perfluorinated substances. Overall, this compound's distinctive features make it of interest in various industrial applications, particularly in fields requiring specialized chemical properties.
Formula:C16H13F13O2
InChI:InChI=1/C16H13F13O2/c1-30-9-3-5-10(6-4-9)31-8-2-7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h3-6H,2,7-8H2,1H3
SMILES:COc1ccc(cc1)OCCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.