
CAS 957229-54-8
:(3S)-3-(Methylamino)butanoic acid
Description:
(3S)-3-(Methylamino)butanoic acid, also known as a derivative of the amino acid L-leucine, is characterized by its chiral center at the third carbon, which contributes to its specific stereochemistry. This compound features a butanoic acid backbone with a methylamino group attached to the third carbon, influencing its biological activity and solubility. It is a polar molecule due to the presence of the carboxylic acid and amino functional groups, which can engage in hydrogen bonding, enhancing its solubility in water. The compound is likely to exhibit properties typical of amino acids, such as being a zwitterion at physiological pH, which affects its interaction with biological systems. Its potential applications may include roles in pharmaceuticals, biochemistry, and as a building block in peptide synthesis. As with many amino acid derivatives, it may also participate in various metabolic pathways, making it of interest in both research and therapeutic contexts. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C5H11NO2
InChI:InChI=1S/C5H11NO2/c1-4(6-2)3-5(7)8/h4,6H,3H2,1-2H3,(H,7,8)/t4-/m0/s1
InChI key:InChIKey=VWQSQYOPIHNGBY-BYPYZUCNSA-N
SMILES:[C@H](CC(O)=O)(NC)C
Synonyms:- (3S)-3-(Methylamino)butanoic acid
- Butanoic acid, 3-(methylamino)-, (3S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.