CAS 957261-55-1
:1-ethyl-5-methyl-1H-pyrazole-4-sulfonyl chloride
Description:
1-Ethyl-5-methyl-1H-pyrazole-4-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a pyrazole ring, a five-membered aromatic heterocycle containing two nitrogen atoms, contributing to its unique chemical properties. The presence of the ethyl and methyl groups enhances its hydrophobic characteristics, influencing its solubility and reactivity in various solvents. As a sulfonyl chloride, it is typically used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other derivatives. The compound is likely to be sensitive to moisture, as sulfonyl chlorides can hydrolyze to form sulfonic acids. Safety precautions are essential when handling this substance due to its corrosive nature and potential to release toxic gases upon reaction with water or amines. Overall, 1-ethyl-5-methyl-1H-pyrazole-4-sulfonyl chloride is a valuable intermediate in synthetic organic chemistry, particularly in pharmaceutical and agrochemical applications.
Formula:C6H9ClN2O2S
InChI:InChI=1/C6H9ClN2O2S/c1-3-9-5(2)6(4-8-9)12(7,10)11/h4H,3H2,1-2H3
SMILES:CCn1c(C)c(cn1)S(=O)(=O)Cl
Synonyms:- 1H-Pyrazole-4-sulfonyl chloride, 1-ethyl-5-methyl-
- 1-Ethyl-5-methyl-1H-pyrazole-4-sulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
