CAS 957261-64-2
:2-Chloro-N-(1-methyl-1H-pyrazol-4-yl)acetamide
Description:
2-Chloro-N-(1-methyl-1H-pyrazol-4-yl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro substituent and a pyrazole moiety. This compound features a chloro group attached to the second carbon of the acetamide functional group, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of the 1-methyl-1H-pyrazol-4-yl group enhances its biological activity, making it of interest in pharmaceutical research. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and varying degrees of stability under different conditions. The molecular structure suggests potential interactions with biological targets, which could lead to therapeutic applications. Additionally, the compound's CAS number, 957261-64-2, allows for easy identification and reference in chemical databases. Overall, 2-Chloro-N-(1-methyl-1H-pyrazol-4-yl)acetamide represents a class of compounds that may have significant implications in drug development and other chemical applications.
Formula:C6H8ClN3O
InChI:InChI=1S/C6H8ClN3O/c1-10-4-5(3-8-10)9-6(11)2-7/h3-4H,2H2,1H3,(H,9,11)
InChI key:InChIKey=JKMBFTFWNDHJCA-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C1=CN(C)N=C1
Synonyms:- 2-Chloro-N-(1-methyl-1H-pyrazol-4-yl)acetamide
- Acetamide, 2-chloro-N-(1-methyl-1H-pyrazol-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.