CymitQuimica logo

CAS 957261-73-3

:

4-amino-N,1-dimethyl-1H-pyrazole-5-carboxamide

Description:
4-amino-N,1-dimethyl-1H-pyrazole-5-carboxamide is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a carboxamide group (-C(=O)NH2) that contribute to its reactivity and potential biological activity. The dimethyl substitution at the nitrogen atom enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The presence of the carboxamide group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit various pharmacological properties, including anti-inflammatory or antitumor activities, although specific biological effects would depend on further empirical studies. Its CAS number, 957261-73-3, allows for precise identification and retrieval of information regarding its synthesis, properties, and applications in scientific literature. Overall, 4-amino-N,1-dimethyl-1H-pyrazole-5-carboxamide represents a versatile scaffold for further chemical modifications and investigations in drug development.
Formula:C6H10N4O
InChI:InChI=1/C6H10N4O/c1-8-6(11)5-4(7)3-9-10(5)2/h3H,7H2,1-2H3,(H,8,11)
SMILES:CNC(=O)c1c(cnn1C)N
Synonyms:
  • 1H-pyrazole-5-carboxamide, 4-amino-N,1-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.