CAS 957310-67-7
:1-[(2-Chlorophenyl)methyl]-3-nitro-1H-pyrazole
Description:
1-[(2-Chlorophenyl)methyl]-3-nitro-1H-pyrazole, identified by its CAS number 957310-67-7, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a 2-chlorobenzyl group attached to one nitrogen of the pyrazole, contributing to its lipophilicity and potential biological activity. The presence of a nitro group at the 3-position of the pyrazole ring enhances its reactivity and may influence its pharmacological properties. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. The molecular structure suggests that it may exhibit various properties, including potential anti-inflammatory or antimicrobial activities, although specific biological effects would require empirical investigation. As with many organic compounds, safety and handling precautions should be observed, given the presence of chlorine and nitro functional groups, which can impart toxicity or environmental concerns.
Formula:C10H8ClN3O2
InChI:InChI=1S/C10H8ClN3O2/c11-9-4-2-1-3-8(9)7-13-6-5-10(12-13)14(15)16/h1-6H,7H2
InChI key:InChIKey=MTLHJADQYGMFGC-UHFFFAOYSA-N
SMILES:C(N1N=C(N(=O)=O)C=C1)C2=C(Cl)C=CC=C2
Synonyms:- 1H-Pyrazole, 1-[(2-chlorophenyl)methyl]-3-nitro-
- 1-(2-Chlorobenzyl)-3-nitro-1H-pyrazole
- 1-(2-Chloro-benzyl)-3-nitro-1H-pyrazole
- 1-[(2-Chlorophenyl)methyl]-3-nitro-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
