CAS 957313-20-1
:1-[(2-Methoxyphenyl)methyl]-3-methyl-1H-pyrazol-5-amine
Description:
1-[(2-Methoxyphenyl)methyl]-3-methyl-1H-pyrazol-5-amine is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a methoxy-substituted phenyl group attached to a methyl group at the 1-position of the pyrazole, along with an amine functional group at the 5-position. The presence of the methoxy group enhances its lipophilicity and may influence its biological activity. The compound is likely to exhibit moderate to high solubility in organic solvents due to its aromatic and aliphatic components. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrazole derivatives are known for various biological activities, including anti-inflammatory and analgesic properties. The specific interactions and reactivity of this compound would depend on its functional groups and overall molecular conformation, making it a subject of interest for further research in drug design and synthesis.
Formula:C12H15N3O
InChI:InChI=1S/C12H15N3O/c1-9-7-12(13)15(14-9)8-10-5-3-4-6-11(10)16-2/h3-7H,8,13H2,1-2H3
InChI key:InChIKey=JAHFKQSEHNXHST-UHFFFAOYSA-N
SMILES:C(C1=C(OC)C=CC=C1)N2C(N)=CC(C)=N2
Synonyms:- 1H-Pyrazol-5-amine, 1-[(2-methoxyphenyl)methyl]-3-methyl-
- 1-[(2-Methoxyphenyl)methyl]-3-methyl-1H-pyrazol-5-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.