CAS 95732-42-6
:L-Valinamide, L-isoleucyl-L-lysyl-L-isoleucyl-L-methionyl-L-α-aspartyl-L-isoleucyl-L-leucyl-L-alanyl-L-lysyl-L-leucylglycyl-L-lysyl-L-valyl-L-leucyl-L-alanyl-L-histidyl-
Description:
L-Valinamide, L-isoleucyl-L-lysyl-L-isoleucyl-L-methionyl-L-α-aspartyl-L-isoleucyl-L-leucyl-L-alanyl-L-lysyl-L-leucylglycyl-L-lysyl-L-valyl-L-leucyl-L-alanyl-L-histidyl- is a complex peptide composed of multiple amino acids, specifically designed for various biochemical applications. This substance is characterized by its sequence of amino acids, which contributes to its structural and functional properties. Peptides like this one can exhibit unique biological activities, including potential roles in signaling pathways, enzyme regulation, and as building blocks for proteins. The presence of various amino acids, such as valine, isoleucine, lysine, methionine, aspartic acid, leucine, alanine, and histidine, suggests that it may have hydrophobic and hydrophilic regions, influencing its solubility and interaction with other biomolecules. Additionally, the CAS number 95732-42-6 allows for precise identification and reference in scientific literature and databases. Overall, this peptide's characteristics make it a subject of interest in fields such as biochemistry, pharmacology, and molecular biology.
Formula:C87H157N23O19S
InChI:InChI=1/C87H157N23O19S/c1-20-50(14)67(91)84(126)100-58(31-25-28-35-90)79(121)109-70(51(15)21-2)86(128)101-59(32-36-130-19)77(119)104-64(41-66(112)113)83(125)110-71(52(16)22-3)87(129)106-62(39-47(8)9)81(123)96-53(17)73(115)99-57(30-24-27-34-89)76(118)103-60(37-45(4)5)75(117)94-43-65(111)98-56(29-23-26-33-88)78(120)108-69(49(12)13)85(127)105-61(38-46(6)7)80(122)97-54(18)74(116)102-63(40-55-42-93-44-95-55)82(124)107-68(48(10)11)72(92)114/h42,44-54,56-64,67-71H,20-41,43,88-91H2,1-19H3,(H2,92,114)(H,93,95)(H,94,117)(H,96,123)(H,97,122)(H,98,111)(H,99,115)(H,100,126)(H,101,128)(H,102,116)(H,103,118)(H,104,119)(H,105,127)(H,106,129)(H,107,124)(H,108,120)(H,109,121)(H,110,125)(H,112,113)
Synonyms:- L-Valinamide, L-isoleucyl-L-lysyl-L-isoleucyl-L-methionyl-L-α-aspartyl-L-isoleucyl-L-leucyl-L-alanyl-L-lysyl-L-leucylglycyl-L-lysyl-L-valyl-L-leucyl-L-alanyl-L-histidyl-
- Bombolitin III
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Bombolitin III
CAS:Bombolitin III, an antimicrobial peptide sourced from bumblebee venom, possesses lytic activity against erythrocytes and liposomes [1].Formula:C87H157N23O19SColor and Shape:SolidMolecular weight:1861.39
