CAS 957346-62-2

5-Bromo-2-thiazolecarboxylic acid

Description:

5-Bromo-2-thiazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of a thiazole ring, a carboxylic acid functional group, and a bromine atom. The thiazole ring contributes to its aromatic properties and potential reactivity, while the carboxylic acid group provides acidic characteristics, allowing for proton donation in chemical reactions. This compound is typically used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its bromine substituent can enhance biological activity and influence the compound's solubility and stability. Additionally, 5-Bromo-2-thiazolecarboxylic acid may exhibit antimicrobial or antifungal properties, making it of interest in medicinal chemistry. The compound's molecular structure allows for various functionalization possibilities, which can be explored for developing new derivatives with tailored properties. As with many thiazole derivatives, it may also participate in coordination chemistry, forming complexes with metal ions. Safety and handling precautions should be observed due to the presence of bromine and the potential for reactivity.

Formula: C₄H₂BrNO₂S

InChI: InChI=1S/C4H2BrNO2S/c5-2-1-6-3(9-2)4(7)8/h1H,(H,7,8)

InChI key: InChIKey=BQRYPTVDLJGHAU-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1SC(Br)=CN1

Synonyms:

• 2-Thiazolecarboxylic acid, 5-bromo-
• 5-Bromo-1,3-Thiazole-2-Carboxylic Acid
• 5-Bromo-2-thiazolecarboxylic acid
• 5-Bromothiazole-2-carboxylic acid

2-Thiazolecarboxylicacid, 5-bromo-

CAS: 957346-62-2

Formula: C₄H₂BrNO₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 208.0332

Ref: IN-DA00IJFB

5-Bromothiazole-2-carboxylic acid

CAS: 957346-62-2

5-Bromothiazole-2-carboxylic acid

Purity: 97%

Molecular weight: 208.036g/mol

Ref: 54-OR73200

5-Bromothiazole-2-carboxylic acid

CAS: 957346-62-2

Formula: C₄H₂BrNO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 208.03

Ref: 10-F319925